C7H10N6O4S — CID 135457194
6-(1,2,3,4-tetrahydroxybutyl)-2H-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazine-3-thione (PubChem CID 135457194) has the molecular formula C7H10N6O4S and a molecular weight of 274.26 g/mol. Its IUPAC name is 6-(1,2,3,4-tetrahydroxybutyl)-2H-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazine-3-thione.
| Compound Name | 6-(1,2,3,4-tetrahydroxybutyl)-2H-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazine-3-thione |
|---|---|
| PubChem CID | 135457194 |
| Molecular Formula | C7H10N6O4S |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 6-(1,2,3,4-tetrahydroxybutyl)-2H-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazine-3-thione |
| SMILES | OCC(O)C(O)C(O)c1nnc2n[nH]c(=S)n2n1 |
| InChI | InChI=1S/C7H10N6O4S/c14-1-2(15)3(16)4(17)5-8-9-6-10-11-7(18)13(6)12-5/h2-4,14-17H,1H2,(H,11,18) |
| InChIKey | XMSFWCKNLVIGAF-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|