C41H62O6 — CID 138121023
2,3-bis[[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy]propyl (7Z,9Z)-tetradeca-7,9-dienoate (PubChem CID 138121023) has the molecular formula C41H62O6 and a molecular weight of 650.94 g/mol. Its IUPAC name is 2,3-bis[[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy]propyl (7Z,9Z)-tetradeca-7,9-dienoate.
| Compound Name | 2,3-bis[[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy]propyl (7Z,9Z)-tetradeca-7,9-dienoate |
|---|---|
| PubChem CID | 138121023 |
| Molecular Formula | C41H62O6 |
| Molecular Weight | 650.94 g/mol |
| Exact Mass | 650.45 |
| IUPAC Name | 2,3-bis[[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy]propyl (7Z,9Z)-tetradeca-7,9-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CC(=O)OCC(COC(=O)CCCCC/C=C\C=C/CCCC)OC(=O)C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C41H62O6/c1-4-7-10-13-16-19-20-23-25-28-31-34-40(43)46-37-38(47-41(44)35-32-29-26-22-18-15-12-9-6-3)36-45-39(42)33-30-27-24-21-17-14-11-8-5-2/h8-9,11-13,16-22,27,29-30,32,38H,4-7,10,14-15,23-26,28,31,33-37H2,1-3H3/b11-8-,12-9-,16-13-,20-19-,21-17-,22-18-,30-27-,32-29- |
| InChIKey | AQHGNRUEPYQWHX-ZZXWJXDZSA-N |
| XLogP | 10.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.94 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|