C51H82O6 — CID 138215213
[1-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-3-[(11Z,13Z,15Z)-octadeca-11,13,15-trienoyl]oxypropan-2-yl] (10Z,12Z)-octadeca-10,12-dienoate (PubChem CID 138215213) has the molecular formula C51H82O6 and a molecular weight of 791.21 g/mol. Its IUPAC name is [1-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-3-[(11Z,13Z,15Z)-octadeca-11,13,15-trienoyl]oxypropan-2-yl] (10Z,12Z)-octadeca-10,12-dienoate.
| Compound Name | [1-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-3-[(11Z,13Z,15Z)-octadeca-11,13,15-trienoyl]oxypropan-2-yl] (10Z,12Z)-octadeca-10,12-dienoate |
|---|---|
| PubChem CID | 138215213 |
| Molecular Formula | C51H82O6 |
| Molecular Weight | 791.21 g/mol |
| Exact Mass | 790.61 |
| IUPAC Name | [1-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-3-[(11Z,13Z,15Z)-octadeca-11,13,15-trienoyl]oxypropan-2-yl] (10Z,12Z)-octadeca-10,12-dienoate |
| SMILES | CC/C=C\C=C/C=C\CCCCCCCCCC(=O)OCC(COC(=O)C/C=C\C/C=C\C/C=C\CC)OC(=O)CCCCCCCC/C=C\C=C/CCCCC |
| InChI | InChI=1S/C51H82O6/c1-4-7-10-13-16-19-21-23-25-27-29-32-35-38-41-44-50(53)56-47-48(46-55-49(52)43-40-37-34-31-18-15-12-9-6-3)57-51(54)45-42-39-36-33-30-28-26-24-22-20-17-14-11-8-5-2/h7,9-10,12-13,16-22,24,31,37,40,48H,4-6,8,11,14-15,23,25-30,32-36,38-39,41-47H2,1-3H3/b10-7-,12-9-,16-13-,20-17-,21-19-,24-22-,31-18-,40-37- |
| InChIKey | MWGLDMGYKJAFMD-HDGPANFQSA-N |
| XLogP | 14.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.21 |
| LogP ≤ 5 | 14.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|