C49H78O6 — CID 138253014
[3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(9Z,11Z,13Z)-hexadeca-9,11,13-trienoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate (PubChem CID 138253014) has the molecular formula C49H78O6 and a molecular weight of 763.16 g/mol. Its IUPAC name is [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(9Z,11Z,13Z)-hexadeca-9,11,13-trienoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate.
| Compound Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(9Z,11Z,13Z)-hexadeca-9,11,13-trienoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate |
|---|---|
| PubChem CID | 138253014 |
| Molecular Formula | C49H78O6 |
| Molecular Weight | 763.16 g/mol |
| Exact Mass | 762.58 |
| IUPAC Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(9Z,11Z,13Z)-hexadeca-9,11,13-trienoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate |
| SMILES | CC/C=C\C=C/C=C\CCCCCCCC(=O)OC(COC(=O)C/C=C\C/C=C\C/C=C\CC)COC(=O)CCCCCCCC/C=C\C=C/CCCCC |
| InChI | InChI=1S/C49H78O6/c1-4-7-10-13-16-19-21-23-24-26-27-30-33-36-39-42-48(51)54-45-46(44-53-47(50)41-38-35-32-29-18-15-12-9-6-3)55-49(52)43-40-37-34-31-28-25-22-20-17-14-11-8-5-2/h8-9,11-12,14,16-23,29,35,38,46H,4-7,10,13,15,24-28,30-34,36-37,39-45H2,1-3H3/b11-8-,12-9-,17-14-,19-16-,22-20-,23-21-,29-18-,38-35- |
| InChIKey | RKBYJZSLKSYEGU-ZBVTVNLOSA-N |
| XLogP | 13.86 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.16 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|