C50H82O6 — CID 138286953
[3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(Z)-heptadec-7-enoyl]oxypropyl] (11Z,13Z,15Z)-octadeca-11,13,15-trienoate (PubChem CID 138286953) has the molecular formula C50H82O6 and a molecular weight of 779.20 g/mol. Its IUPAC name is [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(Z)-heptadec-7-enoyl]oxypropyl] (11Z,13Z,15Z)-octadeca-11,13,15-trienoate.
| Compound Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(Z)-heptadec-7-enoyl]oxypropyl] (11Z,13Z,15Z)-octadeca-11,13,15-trienoate |
|---|---|
| PubChem CID | 138286953 |
| Molecular Formula | C50H82O6 |
| Molecular Weight | 779.20 g/mol |
| Exact Mass | 778.61 |
| IUPAC Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(Z)-heptadec-7-enoyl]oxypropyl] (11Z,13Z,15Z)-octadeca-11,13,15-trienoate |
| SMILES | CC/C=C\C=C/C=C\CCCCCCCCCC(=O)OCC(COC(=O)C/C=C\C/C=C\C/C=C\CC)OC(=O)CCCCC/C=C\CCCCCCCCC |
| InChI | InChI=1S/C50H82O6/c1-4-7-10-13-16-19-21-23-25-27-28-31-34-37-40-43-49(52)55-46-47(45-54-48(51)42-39-36-33-30-18-15-12-9-6-3)56-50(53)44-41-38-35-32-29-26-24-22-20-17-14-11-8-5-2/h7,9-10,12-13,16,18-19,21,26,29-30,36,39,47H,4-6,8,11,14-15,17,20,22-25,27-28,31-35,37-38,40-46H2,1-3H3/b10-7-,12-9-,16-13-,21-19-,29-26-,30-18-,39-36- |
| InChIKey | WEJZCXUODIBGAI-PXWOJPSCSA-N |
| XLogP | 14.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.20 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|