C56H92O6 — CID 138158424
[3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] (9Z,11Z,13Z)-henicosa-9,11,13-trienoate (PubChem CID 138158424) has the molecular formula C56H92O6 and a molecular weight of 861.35 g/mol. Its IUPAC name is [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] (9Z,11Z,13Z)-henicosa-9,11,13-trienoate.
| Compound Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] (9Z,11Z,13Z)-henicosa-9,11,13-trienoate |
|---|---|
| PubChem CID | 138158424 |
| Molecular Formula | C56H92O6 |
| Molecular Weight | 861.35 g/mol |
| Exact Mass | 860.69 |
| IUPAC Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] (9Z,11Z,13Z)-henicosa-9,11,13-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CC(=O)OCC(COC(=O)CCCCCCC/C=C\C=C/C=C\CCCCCCC)OC(=O)CCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C56H92O6/c1-4-7-10-13-16-19-21-23-25-27-29-30-32-34-37-40-43-46-49-55(58)61-52-53(51-60-54(57)48-45-42-39-36-18-15-12-9-6-3)62-56(59)50-47-44-41-38-35-33-31-28-26-24-22-20-17-14-11-8-5-2/h9,12,17-18,20-21,23-27,29-30,36,42,45,53H,4-8,10-11,13-16,19,22,28,31-35,37-41,43-44,46-52H2,1-3H3/b12-9-,20-17-,23-21-,26-24-,27-25-,30-29-,36-18-,45-42- |
| InChIKey | GCDYAOSVVMRTGK-GAHUCPGBSA-N |
| XLogP | 16.59 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.35 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|