C48H78O6 — CID 138258855
[3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(9Z,12Z)-pentadeca-9,12-dienoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate (PubChem CID 138258855) has the molecular formula C48H78O6 and a molecular weight of 751.15 g/mol. Its IUPAC name is [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(9Z,12Z)-pentadeca-9,12-dienoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate.
| Compound Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(9Z,12Z)-pentadeca-9,12-dienoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate |
|---|---|
| PubChem CID | 138258855 |
| Molecular Formula | C48H78O6 |
| Molecular Weight | 751.15 g/mol |
| Exact Mass | 750.58 |
| IUPAC Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(9Z,12Z)-pentadeca-9,12-dienoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CC(=O)OCC(COC(=O)CCCCCCCC/C=C\C=C/CCCCC)OC(=O)CCCCCCC/C=C\C/C=C\CC |
| InChI | InChI=1S/C48H78O6/c1-4-7-10-13-16-19-21-23-24-25-27-29-32-35-38-41-47(50)53-44-45(43-52-46(49)40-37-34-31-28-18-15-12-9-6-3)54-48(51)42-39-36-33-30-26-22-20-17-14-11-8-5-2/h8-9,11-12,16-21,23,28,34,37,45H,4-7,10,13-15,22,24-27,29-33,35-36,38-44H2,1-3H3/b11-8-,12-9-,19-16-,20-17-,23-21-,28-18-,37-34- |
| InChIKey | SBTYCHWZDQCJMC-KEQFNMKOSA-N |
| XLogP | 13.69 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.15 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|