C53H86O6 — CID 138180395
[3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(11Z,13Z,15Z)-octadeca-11,13,15-trienoyl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate (PubChem CID 138180395) has the molecular formula C53H86O6 and a molecular weight of 819.26 g/mol. Its IUPAC name is [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(11Z,13Z,15Z)-octadeca-11,13,15-trienoyl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate.
| Compound Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(11Z,13Z,15Z)-octadeca-11,13,15-trienoyl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 138180395 |
| Molecular Formula | C53H86O6 |
| Molecular Weight | 819.26 g/mol |
| Exact Mass | 818.64 |
| IUPAC Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(11Z,13Z,15Z)-octadeca-11,13,15-trienoyl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate |
| SMILES | CC/C=C\C=C/C=C\CCCCCCCCCC(=O)OC(COC(=O)C/C=C\C/C=C\C/C=C\CC)COC(=O)CCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C53H86O6/c1-4-7-10-13-16-19-21-23-25-26-28-29-31-34-37-40-43-46-52(55)58-49-50(48-57-51(54)45-42-39-36-33-18-15-12-9-6-3)59-53(56)47-44-41-38-35-32-30-27-24-22-20-17-14-11-8-5-2/h8-9,11-12,14,16-20,22-23,25,33,39,42,50H,4-7,10,13,15,21,24,26-32,34-38,40-41,43-49H2,1-3H3/b11-8-,12-9-,17-14-,19-16-,22-20-,25-23-,33-18-,42-39- |
| InChIKey | ISHQYIGDLPEZHJ-VYGPCWBJSA-N |
| XLogP | 15.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.26 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|