C59H92O6 — CID 138238067
[1-[(7Z,9Z,11E,13Z,15Z,17Z,19Z)-docosa-7,9,11,13,15,17,19-heptaenoyl]oxy-3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxypropan-2-yl] (Z)-docos-11-enoate (PubChem CID 138238067) has the molecular formula C59H92O6 and a molecular weight of 897.38 g/mol. Its IUPAC name is [1-[(7Z,9Z,11E,13Z,15Z,17Z,19Z)-docosa-7,9,11,13,15,17,19-heptaenoyl]oxy-3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxypropan-2-yl] (Z)-docos-11-enoate.
| Compound Name | [1-[(7Z,9Z,11E,13Z,15Z,17Z,19Z)-docosa-7,9,11,13,15,17,19-heptaenoyl]oxy-3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxypropan-2-yl] (Z)-docos-11-enoate |
|---|---|
| PubChem CID | 138238067 |
| Molecular Formula | C59H92O6 |
| Molecular Weight | 897.38 g/mol |
| Exact Mass | 896.69 |
| IUPAC Name | [1-[(7Z,9Z,11E,13Z,15Z,17Z,19Z)-docosa-7,9,11,13,15,17,19-heptaenoyl]oxy-3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxypropan-2-yl] (Z)-docos-11-enoate |
| SMILES | CC/C=C\C=C/C=C\C=C/C=C/C=C\C=C/CCCCCC(=O)OCC(COC(=O)C/C=C\C/C=C\C/C=C\CC)OC(=O)CCCCCCCCC/C=C\CCCCCCCCCC |
| InChI | InChI=1S/C59H92O6/c1-4-7-10-13-16-19-21-23-25-27-29-31-33-35-37-40-43-46-49-52-58(61)64-55-56(54-63-57(60)51-48-45-42-39-18-15-12-9-6-3)65-59(62)53-50-47-44-41-38-36-34-32-30-28-26-24-22-20-17-14-11-8-5-2/h7,9-10,12-13,16,18-19,21,23,25,27-31,33,35,37,39,45,48,56H,4-6,8,11,14-15,17,20,22,24,26,32,34,36,38,40-44,46-47,49-55H2,1-3H3/b10-7-,12-9-,16-13-,21-19-,25-23-,29-27+,30-28-,33-31-,37-35-,39-18-,48-45- |
| InChIKey | PPQZAVAQBLUUFH-XHNZBAGMSA-N |
| XLogP | 17.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.38 |
| LogP ≤ 5 | 17.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|