C57H86O6 — CID 138205609
[3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] (7Z,9Z,11E,13Z,15Z,17Z,19Z)-docosa-7,9,11,13,15,17,19-heptaenoate (PubChem CID 138205609) has the molecular formula C57H86O6 and a molecular weight of 867.31 g/mol. Its IUPAC name is [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] (7Z,9Z,11E,13Z,15Z,17Z,19Z)-docosa-7,9,11,13,15,17,19-heptaenoate.
| Compound Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] (7Z,9Z,11E,13Z,15Z,17Z,19Z)-docosa-7,9,11,13,15,17,19-heptaenoate |
|---|---|
| PubChem CID | 138205609 |
| Molecular Formula | C57H86O6 |
| Molecular Weight | 867.31 g/mol |
| Exact Mass | 866.64 |
| IUPAC Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] (7Z,9Z,11E,13Z,15Z,17Z,19Z)-docosa-7,9,11,13,15,17,19-heptaenoate |
| SMILES | CC/C=C\C=C/C=C\C=C/C=C/C=C\C=C/CCCCCC(=O)OCC(COC(=O)C/C=C\C/C=C\C/C=C\CC)OC(=O)CCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C57H86O6/c1-4-7-10-13-16-19-21-23-25-27-28-30-31-33-35-38-41-44-47-50-56(59)62-53-54(52-61-55(58)49-46-43-40-37-18-15-12-9-6-3)63-57(60)51-48-45-42-39-36-34-32-29-26-24-22-20-17-14-11-8-5-2/h7,9-10,12-13,16-21,23-28,30-31,33,35,37,43,46,54H,4-6,8,11,14-15,22,29,32,34,36,38-42,44-45,47-53H2,1-3H3/b10-7-,12-9-,16-13-,20-17-,21-19-,25-23-,26-24-,28-27+,31-30-,35-33-,37-18-,46-43- |
| InChIKey | LSTUWQCUFVREBG-USJRHVDVSA-N |
| XLogP | 16.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.31 |
| LogP ≤ 5 | 16.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|