C28H52NO7P — CID 138134609
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] propanoate (PubChem CID 138134609) has the molecular formula C28H52NO7P and a molecular weight of 545.70 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] propanoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] propanoate |
|---|---|
| PubChem CID | 138134609 |
| Molecular Formula | C28H52NO7P |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.35 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11Z,14Z,17Z)-icosa-11,14,17-trienoxy]propan-2-yl] propanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCCOCC(COP(=O)(O)OCCN)OC(=O)CC |
| InChI | InChI=1S/C28H52NO7P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-33-25-27(36-28(30)4-2)26-35-37(31,32)34-24-22-29/h5-6,8-9,11-12,27H,3-4,7,10,13-26,29H2,1-2H3,(H,31,32)/b6-5-,9-8-,12-11- |
| InChIKey | CGGZDRKQTYASEX-AGRJPVHOSA-N |
| XLogP | 6.79 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|