C26H50NO7P — CID 138298965
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-yl] propanoate (PubChem CID 138298965) has the molecular formula C26H50NO7P and a molecular weight of 519.66 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-yl] propanoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-yl] propanoate |
|---|---|
| PubChem CID | 138298965 |
| Molecular Formula | C26H50NO7P |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.33 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-yl] propanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(COP(=O)(O)OCCN)OC(=O)CC |
| InChI | InChI=1S/C26H50NO7P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-31-23-25(34-26(28)4-2)24-33-35(29,30)32-22-20-27/h8-9,11-12,25H,3-7,10,13-24,27H2,1-2H3,(H,29,30)/b9-8-,12-11- |
| InChIKey | XPVWBFCFXZYIHZ-MURFETPASA-N |
| XLogP | 6.23 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|