C35H60O4 — CID 138168486
8-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxypentadecanoic acid (PubChem CID 138168486) has the molecular formula C35H60O4 and a molecular weight of 544.86 g/mol. Its IUPAC name is 8-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxypentadecanoic acid.
| Compound Name | 8-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxypentadecanoic acid |
|---|---|
| PubChem CID | 138168486 |
| Molecular Formula | C35H60O4 |
| Molecular Weight | 544.86 g/mol |
| Exact Mass | 544.45 |
| IUPAC Name | 8-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxypentadecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)OC(CCCCCCC)CCCCCCC(=O)O |
| InChI | InChI=1S/C35H60O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-22-28-32-35(38)39-33(29-25-21-8-6-4-2)30-26-23-24-27-31-34(36)37/h5,7,10-11,13-14,16-17,33H,3-4,6,8-9,12,15,18-32H2,1-2H3,(H,36,37)/b7-5-,11-10-,14-13-,17-16- |
| InChIKey | HHMWICMHKUACBS-ZRENGBSJSA-N |
| XLogP | 10.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.86 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|