C29H51NO8P+ — CID 138191228
2-[[2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxy-3-pentanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138191228) has the molecular formula C29H51NO8P+ and a molecular weight of 572.70 g/mol. Its IUPAC name is 2-[[2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxy-3-pentanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxy-3-pentanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138191228 |
| Molecular Formula | C29H51NO8P+ |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | 2-[[2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxy-3-pentanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(COC(=O)CCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C29H50NO8P/c1-6-8-10-11-12-13-14-15-16-17-18-19-20-22-29(32)38-27(25-35-28(31)21-9-7-2)26-37-39(33,34)36-24-23-30(3,4)5/h8,10,12-13,15-16,18-19,27H,6-7,9,11,14,17,20-26H2,1-5H3/p+1/b10-8-,13-12-,16-15-,19-18- |
| InChIKey | JZUVIGQLRPARPS-JAWPMMNVSA-O |
| XLogP | 6.06 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|