C33H58O10 — CID 138229411
[1-propanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate (PubChem CID 138229411) has the molecular formula C33H58O10 and a molecular weight of 614.82 g/mol. Its IUPAC name is [1-propanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate.
| Compound Name | [1-propanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
|---|---|
| PubChem CID | 138229411 |
| Molecular Formula | C33H58O10 |
| Molecular Weight | 614.82 g/mol |
| Exact Mass | 614.40 |
| IUPAC Name | [1-propanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(COC(=O)CC)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C33H58O10/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-29(36)42-26(24-40-28(35)4-2)25-41-33-32(39)31(38)30(37)27(23-34)43-33/h9-10,12-13,26-27,30-34,37-39H,3-8,11,14-25H2,1-2H3/b10-9-,13-12- |
| InChIKey | OOTGHVCQQKWVTL-UTJQPWESSA-N |
| XLogP | 4.65 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.82 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|