C29H50O10 — CID 138276631
[1-propanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9Z,12Z)-heptadeca-9,12-dienoate (PubChem CID 138276631) has the molecular formula C29H50O10 and a molecular weight of 558.71 g/mol. Its IUPAC name is [1-propanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9Z,12Z)-heptadeca-9,12-dienoate.
| Compound Name | [1-propanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9Z,12Z)-heptadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138276631 |
| Molecular Formula | C29H50O10 |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | [1-propanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9Z,12Z)-heptadeca-9,12-dienoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CC)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C29H50O10/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25(32)38-22(20-36-24(31)4-2)21-37-29-28(35)27(34)26(33)23(19-30)39-29/h7-8,10-11,22-23,26-30,33-35H,3-6,9,12-21H2,1-2H3/b8-7-,11-10- |
| InChIKey | UYRAGQPVRGKYPQ-NQLNTKRDSA-N |
| XLogP | 3.09 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|