C41H70O10 — CID 134732234
[(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (6E,9E,12E)-octadeca-6,9,12-trienoate (PubChem CID 134732234) has the molecular formula C41H70O10 and a molecular weight of 723.00 g/mol. Its IUPAC name is [(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (6E,9E,12E)-octadeca-6,9,12-trienoate.
| Compound Name | [(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (6E,9E,12E)-octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 134732234 |
| Molecular Formula | C41H70O10 |
| Molecular Weight | 723.00 g/mol |
| Exact Mass | 722.50 |
| IUPAC Name | [(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (6E,9E,12E)-octadeca-6,9,12-trienoate |
| SMILES | CCCC/C=C/CCCCCCCC(=O)OC[C@H](CO[C@@H]1O[C@H](CO)[C@H](O)C(O)C1O)OC(=O)CCCC/C=C/C/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C41H70O10/c1-3-5-7-9-11-13-15-16-17-18-20-22-24-26-28-30-37(44)50-34(33-49-41-40(47)39(46)38(45)35(31-42)51-41)32-48-36(43)29-27-25-23-21-19-14-12-10-8-6-4-2/h10-13,16-17,20,22,34-35,38-42,45-47H,3-9,14-15,18-19,21,23-33H2,1-2H3/b12-10+,13-11+,17-16+,22-20+/t34-,35-,38+,39?,40?,41-/m1/s1 |
| InChIKey | GFVGQRKURKCQFI-YGOJHIGSSA-N |
| XLogP | 7.32 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.00 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|