C44H78O10 — CID 138286480
[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (Z)-octadec-9-enoate (PubChem CID 138286480) has the molecular formula C44H78O10 and a molecular weight of 767.10 g/mol. Its IUPAC name is [2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 138286480 |
| Molecular Formula | C44H78O10 |
| Molecular Weight | 767.10 g/mol |
| Exact Mass | 766.56 |
| IUPAC Name | [2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCCCCC)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C44H78O10/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-39(46)51-35-37(36-52-44-43(50)42(49)41(48)38(34-45)54-44)53-40(47)33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h10,12,16-19,37-38,41-45,48-50H,3-9,11,13-15,20-36H2,1-2H3/b12-10-,18-16-,19-17- |
| InChIKey | WCWHRBNUMRWOMA-HZWFLXIQSA-N |
| XLogP | 8.72 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.10 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|