C43H76O10 — CID 134747476
[(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11E,14E)-icosa-11,14-dienoate (PubChem CID 134747476) has the molecular formula C43H76O10 and a molecular weight of 753.07 g/mol. Its IUPAC name is [(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11E,14E)-icosa-11,14-dienoate.
| Compound Name | [(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11E,14E)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 134747476 |
| Molecular Formula | C43H76O10 |
| Molecular Weight | 753.07 g/mol |
| Exact Mass | 752.54 |
| IUPAC Name | [(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11E,14E)-icosa-11,14-dienoate |
| SMILES | CCCC/C=C/CCCCCCCC(=O)OC[C@H](CO[C@@H]1O[C@H](CO)[C@H](O)C(O)C1O)OC(=O)CCCCCCCCC/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C43H76O10/c1-3-5-7-9-11-13-15-16-17-18-19-20-22-24-26-28-30-32-39(46)52-36(35-51-43-42(49)41(48)40(47)37(33-44)53-43)34-50-38(45)31-29-27-25-23-21-14-12-10-8-6-4-2/h10-13,16-17,36-37,40-44,47-49H,3-9,14-15,18-35H2,1-2H3/b12-10+,13-11+,17-16+/t36-,37-,40+,41?,42?,43-/m1/s1 |
| InChIKey | LPGHWCSOIUWSHC-KMDNTBOVSA-N |
| XLogP | 8.33 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.07 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|