C46H82O10 — CID 134749837
[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-icos-11-enoate (PubChem CID 134749837) has the molecular formula C46H82O10 and a molecular weight of 795.15 g/mol. Its IUPAC name is [(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-icos-11-enoate.
| Compound Name | [(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-icos-11-enoate |
|---|---|
| PubChem CID | 134749837 |
| Molecular Formula | C46H82O10 |
| Molecular Weight | 795.15 g/mol |
| Exact Mass | 794.59 |
| IUPAC Name | [(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-icos-11-enoate |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCC(=O)O[C@@H](COC(=O)CCCCCCCCC/C=C/CCCCCCCC)CO[C@H]1O[C@@H](CO)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C46H82O10/c1-3-5-7-9-11-13-15-17-19-20-21-23-24-26-28-30-32-34-41(48)53-37-39(38-54-46-45(52)44(51)43(50)40(36-47)56-46)55-42(49)35-33-31-29-27-25-22-18-16-14-12-10-8-6-4-2/h10,12,16-19,39-40,43-47,50-52H,3-9,11,13-15,20-38H2,1-2H3/b12-10+,18-16+,19-17+/t39-,40-,43+,44?,45?,46-/m0/s1 |
| InChIKey | MKYPFAWRWUJMEC-FMTFZCORSA-N |
| XLogP | 9.50 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.15 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|