C46H80O10 — CID 134771951
[(2S)-1-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11E,14E)-icosa-11,14-dienoate (PubChem CID 134771951) has the molecular formula C46H80O10 and a molecular weight of 793.14 g/mol. Its IUPAC name is [(2S)-1-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11E,14E)-icosa-11,14-dienoate.
| Compound Name | [(2S)-1-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11E,14E)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 134771951 |
| Molecular Formula | C46H80O10 |
| Molecular Weight | 793.14 g/mol |
| Exact Mass | 792.58 |
| IUPAC Name | [(2S)-1-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (11E,14E)-icosa-11,14-dienoate |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCC(=O)OC[C@H](CO[C@@H]1O[C@H](CO)[C@H](O)C(O)C1O)OC(=O)CCCCCCCCC/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C46H80O10/c1-3-5-7-9-11-13-15-17-19-20-21-23-25-27-29-31-33-35-42(49)55-39(38-54-46-45(52)44(51)43(50)40(36-47)56-46)37-53-41(48)34-32-30-28-26-24-22-18-16-14-12-10-8-6-4-2/h10-13,16-19,39-40,43-47,50-52H,3-9,14-15,20-38H2,1-2H3/b12-10+,13-11+,18-16+,19-17+/t39-,40-,43+,44?,45?,46-/m1/s1 |
| InChIKey | UWPHKXWLXZRMPQ-SZSLBYIZSA-N |
| XLogP | 9.27 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.14 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|