C45H81O10P — CID 138229504
[1-hydroxy-3-[hydroxy-[3-hydroxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropoxy]phosphoryl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate (PubChem CID 138229504) has the molecular formula C45H81O10P and a molecular weight of 813.11 g/mol. Its IUPAC name is [1-hydroxy-3-[hydroxy-[3-hydroxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropoxy]phosphoryl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate.
| Compound Name | [1-hydroxy-3-[hydroxy-[3-hydroxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropoxy]phosphoryl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
|---|---|
| PubChem CID | 138229504 |
| Molecular Formula | C45H81O10P |
| Molecular Weight | 813.11 g/mol |
| Exact Mass | 812.56 |
| IUPAC Name | [1-hydroxy-3-[hydroxy-[3-hydroxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropoxy]phosphoryl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(CO)COP(=O)(O)OCC(CO)OC(=O)CCCCCCCCC/C=C\C/C=C\CCCCCC |
| InChI | InChI=1S/C45H81O10P/c1-3-5-7-9-11-13-15-17-19-20-21-23-25-27-29-31-33-35-37-45(49)55-43(39-47)41-53-56(50,51)52-40-42(38-46)54-44(48)36-34-32-30-28-26-24-22-18-16-14-12-10-8-6-4-2/h12-15,18-20,22,42-43,46-47H,3-11,16-17,21,23-41H2,1-2H3,(H,50,51)/b14-12-,15-13-,20-19-,22-18- |
| InChIKey | OPBDZYDUXLKIEZ-LFVVPAGSSA-N |
| XLogP | 11.73 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.11 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|