C47H87O10P — CID 138268199
[1-hydroxy-3-[hydroxy-[3-hydroxy-2-[(Z)-icos-11-enoyl]oxypropoxy]phosphoryl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate (PubChem CID 138268199) has the molecular formula C47H87O10P and a molecular weight of 843.18 g/mol. Its IUPAC name is [1-hydroxy-3-[hydroxy-[3-hydroxy-2-[(Z)-icos-11-enoyl]oxypropoxy]phosphoryl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate.
| Compound Name | [1-hydroxy-3-[hydroxy-[3-hydroxy-2-[(Z)-icos-11-enoyl]oxypropoxy]phosphoryl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
|---|---|
| PubChem CID | 138268199 |
| Molecular Formula | C47H87O10P |
| Molecular Weight | 843.18 g/mol |
| Exact Mass | 842.60 |
| IUPAC Name | [1-hydroxy-3-[hydroxy-[3-hydroxy-2-[(Z)-icos-11-enoyl]oxypropoxy]phosphoryl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(CO)COP(=O)(O)OCC(CO)OC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C47H87O10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-47(51)57-45(41-49)43-55-58(52,53)54-42-44(40-48)56-46(50)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h13,15,18-21,44-45,48-49H,3-12,14,16-17,22-43H2,1-2H3,(H,52,53)/b15-13-,20-18-,21-19- |
| InChIKey | TYHVPUUGQMJTPQ-MXLPAPOISA-N |
| XLogP | 12.73 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.18 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|