C34H63O10P — CID 138268906
[1-hydroxy-3-[hydroxy-(3-hydroxy-2-octanoyloxypropoxy)phosphoryl]oxypropan-2-yl] (11Z,14Z)-icosa-11,14-dienoate (PubChem CID 138268906) has the molecular formula C34H63O10P and a molecular weight of 662.84 g/mol. Its IUPAC name is [1-hydroxy-3-[hydroxy-(3-hydroxy-2-octanoyloxypropoxy)phosphoryl]oxypropan-2-yl] (11Z,14Z)-icosa-11,14-dienoate.
| Compound Name | [1-hydroxy-3-[hydroxy-(3-hydroxy-2-octanoyloxypropoxy)phosphoryl]oxypropan-2-yl] (11Z,14Z)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 138268906 |
| Molecular Formula | C34H63O10P |
| Molecular Weight | 662.84 g/mol |
| Exact Mass | 662.42 |
| IUPAC Name | [1-hydroxy-3-[hydroxy-(3-hydroxy-2-octanoyloxypropoxy)phosphoryl]oxypropan-2-yl] (11Z,14Z)-icosa-11,14-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(CO)COP(=O)(O)OCC(CO)OC(=O)CCCCCCC |
| InChI | InChI=1S/C34H63O10P/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-22-24-26-34(38)44-32(28-36)30-42-45(39,40)41-29-31(27-35)43-33(37)25-23-21-8-6-4-2/h10-11,13-14,31-32,35-36H,3-9,12,15-30H2,1-2H3,(H,39,40)/b11-10-,14-13- |
| InChIKey | UAPPUEDESICGLB-XVTLYKPTSA-N |
| XLogP | 7.88 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.84 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|