C41H75O10P — CID 138303618
[1-[[2-[(Z)-hexadec-9-enoyl]oxy-3-hydroxypropoxy]-hydroxyphosphoryl]oxy-3-hydroxypropan-2-yl] (9Z,12Z)-nonadeca-9,12-dienoate (PubChem CID 138303618) has the molecular formula C41H75O10P and a molecular weight of 759.01 g/mol. Its IUPAC name is [1-[[2-[(Z)-hexadec-9-enoyl]oxy-3-hydroxypropoxy]-hydroxyphosphoryl]oxy-3-hydroxypropan-2-yl] (9Z,12Z)-nonadeca-9,12-dienoate.
| Compound Name | [1-[[2-[(Z)-hexadec-9-enoyl]oxy-3-hydroxypropoxy]-hydroxyphosphoryl]oxy-3-hydroxypropan-2-yl] (9Z,12Z)-nonadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138303618 |
| Molecular Formula | C41H75O10P |
| Molecular Weight | 759.01 g/mol |
| Exact Mass | 758.51 |
| IUPAC Name | [1-[[2-[(Z)-hexadec-9-enoyl]oxy-3-hydroxypropoxy]-hydroxyphosphoryl]oxy-3-hydroxypropan-2-yl] (9Z,12Z)-nonadeca-9,12-dienoate |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(CO)COP(=O)(O)OCC(CO)OC(=O)CCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C41H75O10P/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-33-41(45)51-39(35-43)37-49-52(46,47)48-36-38(34-42)50-40(44)32-30-28-26-24-22-20-16-14-12-10-8-6-4-2/h13-16,18-19,38-39,42-43H,3-12,17,20-37H2,1-2H3,(H,46,47)/b15-13-,16-14-,19-18- |
| InChIKey | YEEJSQWAXOKIST-OBMQDGOVSA-N |
| XLogP | 10.39 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.01 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|