C31H52O4 — CID 138229567
7-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxyundecanoic acid (PubChem CID 138229567) has the molecular formula C31H52O4 and a molecular weight of 488.75 g/mol. Its IUPAC name is 7-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxyundecanoic acid.
| Compound Name | 7-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxyundecanoic acid |
|---|---|
| PubChem CID | 138229567 |
| Molecular Formula | C31H52O4 |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 488.39 |
| IUPAC Name | 7-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxyundecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)OC(CCCC)CCCCCC(=O)O |
| InChI | InChI=1S/C31H52O4/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-28-31(34)35-29(25-6-4-2)26-22-21-23-27-30(32)33/h5,7,9-10,12-13,15-16,29H,3-4,6,8,11,14,17-28H2,1-2H3,(H,32,33)/b7-5-,10-9-,13-12-,16-15- |
| InChIKey | OPEYHLDTPLGKHE-KUXGPOOQSA-N |
| XLogP | 9.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|