C25H40O5 — CID 138240215
(1-hexanoyloxy-3-hydroxypropan-2-yl) (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate (PubChem CID 138240215) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is (1-hexanoyloxy-3-hydroxypropan-2-yl) (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate.
| Compound Name | (1-hexanoyloxy-3-hydroxypropan-2-yl) (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate |
|---|---|
| PubChem CID | 138240215 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (1-hexanoyloxy-3-hydroxypropan-2-yl) (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(CO)COC(=O)CCCCC |
| InChI | InChI=1S/C25H40O5/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-20-25(28)30-23(21-26)22-29-24(27)19-17-6-4-2/h5,7,9-10,12-13,15-16,23,26H,3-4,6,8,11,14,17-22H2,1-2H3/b7-5-,10-9-,13-12-,16-15- |
| InChIKey | PWAIOYRXKHXQJS-KUXGPOOQSA-N |
| XLogP | 5.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|