C26H46O4 — CID 138280532
7-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxydecanoic acid (PubChem CID 138280532) has the molecular formula C26H46O4 and a molecular weight of 422.65 g/mol. Its IUPAC name is 7-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxydecanoic acid.
| Compound Name | 7-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxydecanoic acid |
|---|---|
| PubChem CID | 138280532 |
| Molecular Formula | C26H46O4 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | 7-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxydecanoic acid |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)OC(CCC)CCCCCC(=O)O |
| InChI | InChI=1S/C26H46O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-19-23-26(29)30-24(20-4-2)21-17-16-18-22-25(27)28/h6-7,9-10,24H,3-5,8,11-23H2,1-2H3,(H,27,28)/b7-6-,10-9- |
| InChIKey | VKLBULCHUXCUJR-HZJYTTRNSA-N |
| XLogP | 7.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|