C29H44O5 — CID 138310374
(1-butanoyloxy-3-hydroxypropan-2-yl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 138310374) has the molecular formula C29H44O5 and a molecular weight of 472.67 g/mol. Its IUPAC name is (1-butanoyloxy-3-hydroxypropan-2-yl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | (1-butanoyloxy-3-hydroxypropan-2-yl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 138310374 |
| Molecular Formula | C29H44O5 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | (1-butanoyloxy-3-hydroxypropan-2-yl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(CO)COC(=O)CCC |
| InChI | InChI=1S/C29H44O5/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-29(32)34-27(25-30)26-33-28(31)23-4-2/h5-6,8-9,11-12,14-15,17-18,20-21,27,30H,3-4,7,10,13,16,19,22-26H2,1-2H3/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | YZKYQTVPJPDQKC-YNUSHXQLSA-N |
| XLogP | 6.71 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|