C19H23N9O — CID 138378359
1-[4-[[2-(1-methylpyrazol-4-yl)-5-pentyl-1,2,4-triazol-3-yl]methoxy]phenyl]tetrazole (PubChem CID 138378359) has the molecular formula C19H23N9O and a molecular weight of 393.46 g/mol. Its IUPAC name is 1-[4-[[2-(1-methylpyrazol-4-yl)-5-pentyl-1,2,4-triazol-3-yl]methoxy]phenyl]tetrazole.
| Compound Name | 1-[4-[[2-(1-methylpyrazol-4-yl)-5-pentyl-1,2,4-triazol-3-yl]methoxy]phenyl]tetrazole |
|---|---|
| PubChem CID | 138378359 |
| Molecular Formula | C19H23N9O |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 1-[4-[[2-(1-methylpyrazol-4-yl)-5-pentyl-1,2,4-triazol-3-yl]methoxy]phenyl]tetrazole |
| SMILES | CCCCCc1nc(COc2ccc(-n3cnnn3)cc2)n(-c2cnn(C)c2)n1 |
| InChI | InChI=1S/C19H23N9O/c1-3-4-5-6-18-22-19(28(23-18)16-11-21-26(2)12-16)13-29-17-9-7-15(8-10-17)27-14-20-24-25-27/h7-12,14H,3-6,13H2,1-2H3 |
| InChIKey | KMDCWQAOMWYOFK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|