C18H25N7O — CID 138381705
[5-[[4-amino-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 138381705) has the molecular formula C18H25N7O and a molecular weight of 355.45 g/mol. Its IUPAC name is [5-[[4-amino-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [5-[[4-amino-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 138381705 |
| Molecular Formula | C18H25N7O |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | [5-[[4-amino-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | Cc1cccc(Nc2nc(N)nc(CN3CC4CNCC4(CO)C3)n2)c1 |
| InChI | InChI=1S/C18H25N7O/c1-12-3-2-4-14(5-12)21-17-23-15(22-16(19)24-17)8-25-7-13-6-20-9-18(13,10-25)11-26/h2-5,13,20,26H,6-11H2,1H3,(H3,19,21,22,23,24) |
| InChIKey | PZYARTGULCSUIQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |