C20H26N6O2 — CID 163307359
[(1R,5R,6S,7S)-3-[[4-amino-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol (PubChem CID 163307359) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is [(1R,5R,6S,7S)-3-[[4-amino-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol.
| Compound Name | [(1R,5R,6S,7S)-3-[[4-amino-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol |
|---|---|
| PubChem CID | 163307359 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | [(1R,5R,6S,7S)-3-[[4-amino-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol |
| SMILES | Cc1cccc(Nc2nc(N)nc(CN3C[C@H]4[C@@H](CO)[C@@H]5CC[C@@]4(C3)O5)n2)c1 |
| InChI | InChI=1S/C20H26N6O2/c1-12-3-2-4-13(7-12)22-19-24-17(23-18(21)25-19)9-26-8-15-14(10-27)16-5-6-20(15,11-26)28-16/h2-4,7,14-16,27H,5-6,8-11H2,1H3,(H3,21,22,23,24,25)/t14-,15+,16+,20+/m1/s1 |
| InChIKey | QRULRSBVLHYAOX-OLPIVMHESA-N |
| XLogP | 1.48 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |