C26H26N2OS — CID 138392953
4-(4-methoxyphenyl)-5-methyl-N-(2-methylphenyl)-3-(2-phenylethyl)-1,3-thiazol-2-imine (PubChem CID 138392953) has the molecular formula C26H26N2OS and a molecular weight of 414.57 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-5-methyl-N-(2-methylphenyl)-3-(2-phenylethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(4-methoxyphenyl)-5-methyl-N-(2-methylphenyl)-3-(2-phenylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 138392953 |
| Molecular Formula | C26H26N2OS |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-(4-methoxyphenyl)-5-methyl-N-(2-methylphenyl)-3-(2-phenylethyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(-c2c(C)s/c(=N\c3ccccc3C)n2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N2OS/c1-19-9-7-8-12-24(19)27-26-28(18-17-21-10-5-4-6-11-21)25(20(2)30-26)22-13-15-23(29-3)16-14-22/h4-16H,17-18H2,1-3H3/b27-26- |
| InChIKey | ZTOBJXOAZPKBNO-RQZHXJHFSA-N |
| XLogP | 6.32 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|