C27H28N2OS — CID 138392904
N-(4-ethylphenyl)-4-(4-methoxyphenyl)-5-methyl-3-(2-phenylethyl)-1,3-thiazol-2-imine (PubChem CID 138392904) has the molecular formula C27H28N2OS and a molecular weight of 428.60 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-(4-methoxyphenyl)-5-methyl-3-(2-phenylethyl)-1,3-thiazol-2-imine.
| Compound Name | N-(4-ethylphenyl)-4-(4-methoxyphenyl)-5-methyl-3-(2-phenylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 138392904 |
| Molecular Formula | C27H28N2OS |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-(4-ethylphenyl)-4-(4-methoxyphenyl)-5-methyl-3-(2-phenylethyl)-1,3-thiazol-2-imine |
| SMILES | CCc1ccc(/N=c2\sc(C)c(-c3ccc(OC)cc3)n2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H28N2OS/c1-4-21-10-14-24(15-11-21)28-27-29(19-18-22-8-6-5-7-9-22)26(20(2)31-27)23-12-16-25(30-3)17-13-23/h5-17H,4,18-19H2,1-3H3/b28-27- |
| InChIKey | PDSILUMGJAXTKQ-DQSJHHFOSA-N |
| XLogP | 6.57 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|