C26H22BrClN2OS2 — CID 17389216
4-(5-chlorothiophen-2-yl)-3-[2-(4-methoxyphenyl)ethyl]-N-naphthalen-1-yl-1,3-thiazol-2-imine;hydrobromide (PubChem CID 17389216) has the molecular formula C26H22BrClN2OS2 and a molecular weight of 557.97 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-3-[2-(4-methoxyphenyl)ethyl]-N-naphthalen-1-yl-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | 4-(5-chlorothiophen-2-yl)-3-[2-(4-methoxyphenyl)ethyl]-N-naphthalen-1-yl-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 17389216 |
| Molecular Formula | C26H22BrClN2OS2 |
| Molecular Weight | 557.97 g/mol |
| Exact Mass | 556.00 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-3-[2-(4-methoxyphenyl)ethyl]-N-naphthalen-1-yl-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.COc1ccc(CCn2c(-c3ccc(Cl)s3)cs/c2=N\c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C26H21ClN2OS2.BrH/c1-30-20-11-9-18(10-12-20)15-16-29-23(24-13-14-25(27)32-24)17-31-26(29)28-22-8-4-6-19-5-2-3-7-21(19)22;/h2-14,17H,15-16H2,1H3;1H/b28-26-; |
| InChIKey | LSCGEULRJLFJRD-QVLVYXDLSA-N |
| XLogP | 8.15 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.97 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|