C18H20ClNO9S — CID 138397280
2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxyethyl pyridine-3-carboxylate;sulfuric acid (PubChem CID 138397280) has the molecular formula C18H20ClNO9S and a molecular weight of 461.88 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxyethyl pyridine-3-carboxylate;sulfuric acid.
| Compound Name | 2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxyethyl pyridine-3-carboxylate;sulfuric acid |
|---|---|
| PubChem CID | 138397280 |
| Molecular Formula | C18H20ClNO9S |
| Molecular Weight | 461.88 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxyethyl pyridine-3-carboxylate;sulfuric acid |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCCOC(=O)c1cccnc1.O=S(=O)(O)O |
| InChI | InChI=1S/C18H18ClNO5.H2O4S/c1-18(2,25-15-7-5-14(19)6-8-15)17(22)24-11-10-23-16(21)13-4-3-9-20-12-13;1-5(2,3)4/h3-9,12H,10-11H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | IOOLKHGOVZRWRU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 149.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.88 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|