C21H25N3O3 — CID 138398270
N-(2,5-dibutoxy-4-diazocyclohexa-2,5-dien-1-ylidene)benzamide (PubChem CID 138398270) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(2,5-dibutoxy-4-diazocyclohexa-2,5-dien-1-ylidene)benzamide.
| Compound Name | N-(2,5-dibutoxy-4-diazocyclohexa-2,5-dien-1-ylidene)benzamide |
|---|---|
| PubChem CID | 138398270 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-(2,5-dibutoxy-4-diazocyclohexa-2,5-dien-1-ylidene)benzamide |
| SMILES | CCCCOC1=C/C(=N\C(=O)c2ccccc2)C(OCCCC)=CC1=[N+]=[N-] |
| InChI | InChI=1S/C21H25N3O3/c1-3-5-12-26-19-15-18(24-22)20(27-13-6-4-2)14-17(19)23-21(25)16-10-8-7-9-11-16/h7-11,14-15H,3-6,12-13H2,1-2H3/b23-17+ |
| InChIKey | JKRUPKVOFQRUIG-HAVVHWLPSA-N |
| XLogP | 4.35 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|