C11H12BrClN2S — CID 138399262
1-(4-chlorophenyl)-2-(4,5-dihydro-1H-imidazol-2-yl)ethanethione;hydrobromide (PubChem CID 138399262) has the molecular formula C11H12BrClN2S and a molecular weight of 319.65 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(4,5-dihydro-1H-imidazol-2-yl)ethanethione;hydrobromide.
| Compound Name | 1-(4-chlorophenyl)-2-(4,5-dihydro-1H-imidazol-2-yl)ethanethione;hydrobromide |
|---|---|
| PubChem CID | 138399262 |
| Molecular Formula | C11H12BrClN2S |
| Molecular Weight | 319.65 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(4,5-dihydro-1H-imidazol-2-yl)ethanethione;hydrobromide |
| SMILES | Br.S=C(CC1=NCCN1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H11ClN2S.BrH/c12-9-3-1-8(2-4-9)10(15)7-11-13-5-6-14-11;/h1-4H,5-7H2,(H,13,14);1H |
| InChIKey | JVAJEOUUEOQVID-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|