C20H21N5O4S2 — CID 23212990
N-carbamimidoyl-N-[4-[2-(4,5-dihydro-1H-imidazol-2-yl)ethanethioyl]phenoxy]-3-methylsulfonylbenzamide (PubChem CID 23212990) has the molecular formula C20H21N5O4S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-carbamimidoyl-N-[4-[2-(4,5-dihydro-1H-imidazol-2-yl)ethanethioyl]phenoxy]-3-methylsulfonylbenzamide.
| Compound Name | N-carbamimidoyl-N-[4-[2-(4,5-dihydro-1H-imidazol-2-yl)ethanethioyl]phenoxy]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 23212990 |
| Molecular Formula | C20H21N5O4S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | N-carbamimidoyl-N-[4-[2-(4,5-dihydro-1H-imidazol-2-yl)ethanethioyl]phenoxy]-3-methylsulfonylbenzamide |
| SMILES | [H]/N=C(\N)N(Oc1ccc(C(=S)CC2=NCCN2)cc1)C(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H21N5O4S2/c1-31(27,28)16-4-2-3-14(11-16)19(26)25(20(21)22)29-15-7-5-13(6-8-15)17(30)12-18-23-9-10-24-18/h2-8,11H,9-10,12H2,1H3,(H3,21,22)(H,23,24) |
| InChIKey | FTNBDVLOULZJRO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 137.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|