C12H19ClN4O4S — CID 67725223
1-[[(2S)-2-hydroxypropyl]amino]-1-(3-methylsulfonylbenzoyl)guanidine;hydrochloride (PubChem CID 67725223) has the molecular formula C12H19ClN4O4S and a molecular weight of 350.83 g/mol. Its IUPAC name is 1-[[(2S)-2-hydroxypropyl]amino]-1-(3-methylsulfonylbenzoyl)guanidine;hydrochloride.
| Compound Name | 1-[[(2S)-2-hydroxypropyl]amino]-1-(3-methylsulfonylbenzoyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 67725223 |
| Molecular Formula | C12H19ClN4O4S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 1-[[(2S)-2-hydroxypropyl]amino]-1-(3-methylsulfonylbenzoyl)guanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N(NC[C@H](C)O)C(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H18N4O4S.ClH/c1-8(17)7-15-16(12(13)14)11(18)9-4-3-5-10(6-9)21(2,19)20;/h3-6,8,15,17H,7H2,1-2H3,(H3,13,14);1H/t8-;/m0./s1 |
| InChIKey | JVSOJKCYPAALIZ-QRPNPIFTSA-N |
| XLogP | -0.27 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|