C13H18N4O2S — CID 138402932
3,7-dimethyl-1-(2-oxopropyl)-8-propyl-2-sulfanylidenepurin-6-one (PubChem CID 138402932) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3,7-dimethyl-1-(2-oxopropyl)-8-propyl-2-sulfanylidenepurin-6-one.
| Compound Name | 3,7-dimethyl-1-(2-oxopropyl)-8-propyl-2-sulfanylidenepurin-6-one |
|---|---|
| PubChem CID | 138402932 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3,7-dimethyl-1-(2-oxopropyl)-8-propyl-2-sulfanylidenepurin-6-one |
| SMILES | CCCc1nc2c(c(=O)n(CC(C)=O)c(=S)n2C)n1C |
| InChI | InChI=1S/C13H18N4O2S/c1-5-6-9-14-11-10(15(9)3)12(19)17(7-8(2)18)13(20)16(11)4/h5-7H2,1-4H3 |
| InChIKey | XPSSEBUBVKCIQH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|