C31H31BrN4O2 — CID 138403105
tert-butyl N-[(Z)-[1-(4-bromophenyl)-2,2-bis(1-methylindol-3-yl)ethylidene]amino]carbamate (PubChem CID 138403105) has the molecular formula C31H31BrN4O2 and a molecular weight of 571.52 g/mol. Its IUPAC name is tert-butyl N-[(Z)-[1-(4-bromophenyl)-2,2-bis(1-methylindol-3-yl)ethylidene]amino]carbamate.
| Compound Name | tert-butyl N-[(Z)-[1-(4-bromophenyl)-2,2-bis(1-methylindol-3-yl)ethylidene]amino]carbamate |
|---|---|
| PubChem CID | 138403105 |
| Molecular Formula | C31H31BrN4O2 |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | tert-butyl N-[(Z)-[1-(4-bromophenyl)-2,2-bis(1-methylindol-3-yl)ethylidene]amino]carbamate |
| SMILES | Cn1cc(C(/C(=N/NC(=O)OC(C)(C)C)c2ccc(Br)cc2)c2cn(C)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C31H31BrN4O2/c1-31(2,3)38-30(37)34-33-29(20-14-16-21(32)17-15-20)28(24-18-35(4)26-12-8-6-10-22(24)26)25-19-36(5)27-13-9-7-11-23(25)27/h6-19,28H,1-5H3,(H,34,37)/b33-29+ |
| InChIKey | ZZDPTQHXHQDTMO-XPXRSFDGSA-N |
| XLogP | 7.49 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|