C22H29N — CID 138456770
N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline (PubChem CID 138456770) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline.
| Compound Name | N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline |
|---|---|
| PubChem CID | 138456770 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline |
| SMILES | Cc1ccc(N(C)c2ccc(C3CCC(C)(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C22H29N/c1-17-5-9-20(10-6-17)23(4)21-11-7-18(8-12-21)19-13-15-22(2,3)16-14-19/h5-12,19H,13-16H2,1-4H3 |
| InChIKey | XEDTZSQWZMFXRH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |