About N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline
N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline (PubChem CID 138456770) has the molecular formula C22H29N
and a molecular weight of 307.48 g/mol. Its IUPAC name is N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline.
Molecular Properties
| Compound Name | N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline |
| PubChem CID | 138456770 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline |
| SMILES | Cc1ccc(N(C)c2ccc(C3CCC(C)(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C22H29N/c1-17-5-9-20(10-6-17)23(4)21-11-7-18(8-12-21)19-13-15-22(2,3)16-14-19/h5-12,19H,13-16H2,1-4H3 |
| InChIKey | XEDTZSQWZMFXRH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline?
The IUPAC name of N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline (CID 138456770) is N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline.
What is the SMILES notation for N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline?
The canonical SMILES for N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline is Cc1ccc(N(C)c2ccc(C3CCC(C)(C)CC3)cc2)cc1.
What is the InChIKey of N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline?
The InChIKey is XEDTZSQWZMFXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N/c1-17-5-9-20(10-6-17)23(4)21-11-7-18(8-12-21)19-13-15-22(2,3)16-14-19/h5-12,19H,13-16H2,1-4H3.
What are the key properties of N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline?
N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline has a molecular weight of 307.48 g/mol, XLogP of 6.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4,4-dimethylcyclohexyl)phenyl]-N,4-dimethylaniline is sourced from PubChem (CID 138456770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).