C23H29N — CID 153373655
ethane;1-methyl-4-[4-(4-methylphenyl)phenyl]cyclohexane-1-carbonitrile (PubChem CID 153373655) has the molecular formula C23H29N and a molecular weight of 319.49 g/mol. Its IUPAC name is ethane;1-methyl-4-[4-(4-methylphenyl)phenyl]cyclohexane-1-carbonitrile.
| Compound Name | ethane;1-methyl-4-[4-(4-methylphenyl)phenyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 153373655 |
| Molecular Formula | C23H29N |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | ethane;1-methyl-4-[4-(4-methylphenyl)phenyl]cyclohexane-1-carbonitrile |
| SMILES | CC.Cc1ccc(-c2ccc(C3CCC(C)(C#N)CC3)cc2)cc1 |
| InChI | InChI=1S/C21H23N.C2H6/c1-16-3-5-17(6-4-16)18-7-9-19(10-8-18)20-11-13-21(2,15-22)14-12-20;1-2/h3-10,20H,11-14H2,1-2H3;1-2H3 |
| InChIKey | FXEIUUGTHZBRNO-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |