C18H26N2O4 — CID 138464033
tert-butyl N-[(3aS,7aR)-4-methyl-7-[(1R,2S)-2-methylcyclopropyl]-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]carbamate (PubChem CID 138464033) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is tert-butyl N-[(3aS,7aR)-4-methyl-7-[(1R,2S)-2-methylcyclopropyl]-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]carbamate.
| Compound Name | tert-butyl N-[(3aS,7aR)-4-methyl-7-[(1R,2S)-2-methylcyclopropyl]-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]carbamate |
|---|---|
| PubChem CID | 138464033 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | tert-butyl N-[(3aS,7aR)-4-methyl-7-[(1R,2S)-2-methylcyclopropyl]-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]carbamate |
| SMILES | CC1C=CC([C@@H]2C[C@@H]2C)[C@H]2C(=O)N(NC(=O)OC(C)(C)C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C18H26N2O4/c1-9-6-7-11(12-8-10(12)2)14-13(9)15(21)20(16(14)22)19-17(23)24-18(3,4)5/h6-7,9-14H,8H2,1-5H3,(H,19,23)/t9?,10-,11?,12+,13-,14+/m0/s1 |
| InChIKey | OEWGVVKROQBVHD-UDWUDOJNSA-N |
| XLogP | 2.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|