C17H20N2O4 — CID 153005730
tert-butyl N-[(2R,7R,9S,11R)-3,5-dioxo-4-azapentacyclo[6.3.2.02,6.02,7.09,11]tridec-12-en-4-yl]carbamate (PubChem CID 153005730) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is tert-butyl N-[(2R,7R,9S,11R)-3,5-dioxo-4-azapentacyclo[6.3.2.02,6.02,7.09,11]tridec-12-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,7R,9S,11R)-3,5-dioxo-4-azapentacyclo[6.3.2.02,6.02,7.09,11]tridec-12-en-4-yl]carbamate |
|---|---|
| PubChem CID | 153005730 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | tert-butyl N-[(2R,7R,9S,11R)-3,5-dioxo-4-azapentacyclo[6.3.2.02,6.02,7.09,11]tridec-12-en-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NN1C(=O)C2[C@H]3C4C=CC([C@@H]5C[C@H]45)[C@]23C1=O |
| InChI | InChI=1S/C17H20N2O4/c1-16(2,3)23-15(22)18-19-13(20)12-11-7-4-5-10(9-6-8(7)9)17(11,12)14(19)21/h4-5,7-12H,6H2,1-3H3,(H,18,22)/t7?,8-,9-,10?,11-,12?,17-/m1/s1 |
| InChIKey | UZBCVFBNBZQSAW-BCAHIOBWSA-N |
| XLogP | 1.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|