C32H40O10 — CID 138465730
2-[4-(furan-3-ylmethyl)-15-hydroxy-4,12,17,19-tetramethyl-6-(2-methylpropanoyl)-7-oxo-8,11,13,20-tetraoxaheptacyclo[10.7.1.114,17.01,10.05,10.09,15.014,19]henicosan-18-yl]acetic acid (PubChem CID 138465730) has the molecular formula C32H40O10 and a molecular weight of 584.66 g/mol. Its IUPAC name is 2-[4-(furan-3-ylmethyl)-15-hydroxy-4,12,17,19-tetramethyl-6-(2-methylpropanoyl)-7-oxo-8,11,13,20-tetraoxaheptacyclo[10.7.1.114,17.01,10.05,10.09,15.014,19]henicosan-18-yl]acetic acid.
| Compound Name | 2-[4-(furan-3-ylmethyl)-15-hydroxy-4,12,17,19-tetramethyl-6-(2-methylpropanoyl)-7-oxo-8,11,13,20-tetraoxaheptacyclo[10.7.1.114,17.01,10.05,10.09,15.014,19]henicosan-18-yl]acetic acid |
|---|---|
| PubChem CID | 138465730 |
| Molecular Formula | C32H40O10 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 2-[4-(furan-3-ylmethyl)-15-hydroxy-4,12,17,19-tetramethyl-6-(2-methylpropanoyl)-7-oxo-8,11,13,20-tetraoxaheptacyclo[10.7.1.114,17.01,10.05,10.09,15.014,19]henicosan-18-yl]acetic acid |
| SMILES | CC(C)C(=O)C1C(=O)OC2C3(O)CC4(C)CC35OC3(C)OC26C1C(C)(Cc1ccoc1)CCC6(O3)C5(C)C4CC(=O)O |
| InChI | InChI=1S/C32H40O10/c1-16(2)21(35)20-22-25(3,12-17-7-10-38-13-17)8-9-30-27(5)18(11-19(33)34)26(4)14-29(37)24(39-23(20)36)32(22,30)42-28(6,40-30)41-31(27,29)15-26/h7,10,13,16,18,20,22,24,37H,8-9,11-12,14-15H2,1-6H3,(H,33,34) |
| InChIKey | RVJITFOWLQZDPA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|