C12H11F2N4O4P — CID 138469939
[4-[(3,3-difluoro-2-oxoindol-1-yl)methyl]triazol-1-yl]methylphosphonic acid (PubChem CID 138469939) has the molecular formula C12H11F2N4O4P and a molecular weight of 344.21 g/mol. Its IUPAC name is [4-[(3,3-difluoro-2-oxoindol-1-yl)methyl]triazol-1-yl]methylphosphonic acid.
| Compound Name | [4-[(3,3-difluoro-2-oxoindol-1-yl)methyl]triazol-1-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 138469939 |
| Molecular Formula | C12H11F2N4O4P |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | [4-[(3,3-difluoro-2-oxoindol-1-yl)methyl]triazol-1-yl]methylphosphonic acid |
| SMILES | O=C1N(Cc2cn(CP(=O)(O)O)nn2)c2ccccc2C1(F)F |
| InChI | InChI=1S/C12H11F2N4O4P/c13-12(14)9-3-1-2-4-10(9)18(11(12)19)6-8-5-17(16-15-8)7-23(20,21)22/h1-5H,6-7H2,(H2,20,21,22) |
| InChIKey | NLUXMUDJPONGKJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|