C8H4F3NO — CID 154502193
1,3,3-trifluoroindol-2-one (PubChem CID 154502193) has the molecular formula C8H4F3NO and a molecular weight of 187.12 g/mol. Its IUPAC name is 1,3,3-trifluoroindol-2-one.
| Compound Name | 1,3,3-trifluoroindol-2-one |
|---|---|
| PubChem CID | 154502193 |
| Molecular Formula | C8H4F3NO |
| Molecular Weight | 187.12 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | 1,3,3-trifluoroindol-2-one |
| SMILES | O=C1N(F)c2ccccc2C1(F)F |
| InChI | InChI=1S/C8H4F3NO/c9-8(10)5-3-1-2-4-6(5)12(11)7(8)13/h1-4H |
| InChIKey | MDLXSKNDNGBSCS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.12 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|