C14H23N3O4S — CID 138472949
butyl N-[2-hydroxy-2-[2-(2-methylpropanoylamino)-1,3-thiazol-5-yl]ethyl]carbamate (PubChem CID 138472949) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is butyl N-[2-hydroxy-2-[2-(2-methylpropanoylamino)-1,3-thiazol-5-yl]ethyl]carbamate.
| Compound Name | butyl N-[2-hydroxy-2-[2-(2-methylpropanoylamino)-1,3-thiazol-5-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 138472949 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | butyl N-[2-hydroxy-2-[2-(2-methylpropanoylamino)-1,3-thiazol-5-yl]ethyl]carbamate |
| SMILES | CCCCOC(=O)NCC(O)c1cnc(NC(=O)C(C)C)s1 |
| InChI | InChI=1S/C14H23N3O4S/c1-4-5-6-21-14(20)16-7-10(18)11-8-15-13(22-11)17-12(19)9(2)3/h8-10,18H,4-7H2,1-3H3,(H,16,20)(H,15,17,19) |
| InChIKey | VKSSRDLENGYJGO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|